C20H17ClN2O2S — CID 154875780
N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-1-benzothiophene-3-carboxamide (PubChem CID 154875780) has the molecular formula C20H17ClN2O2S and a molecular weight of 384.89 g/mol. Its IUPAC name is N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 154875780 |
| Molecular Formula | C20H17ClN2O2S |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-1-benzothiophene-3-carboxamide |
| SMILES | O=C(CCl)N[C@@H]1c2ccccc2C[C@H]1NC(=O)c1csc2ccccc12 |
| InChI | InChI=1S/C20H17ClN2O2S/c21-10-18(24)23-19-13-6-2-1-5-12(13)9-16(19)22-20(25)15-11-26-17-8-4-3-7-14(15)17/h1-8,11,16,19H,9-10H2,(H,22,25)(H,23,24)/t16-,19-/m1/s1 |
| InChIKey | ONMLWHRNOPXPMI-VQIMIIECSA-N |
| XLogP | 3.65 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|