C20H23ClN4O3 — CID 154875707
1-butyl-N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-6-oxopyridazine-3-carboxamide (PubChem CID 154875707) has the molecular formula C20H23ClN4O3 and a molecular weight of 402.88 g/mol. Its IUPAC name is 1-butyl-N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-6-oxopyridazine-3-carboxamide.
| Compound Name | 1-butyl-N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 154875707 |
| Molecular Formula | C20H23ClN4O3 |
| Molecular Weight | 402.88 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-butyl-N-[(1R,2R)-1-[(2-chloroacetyl)amino]-2,3-dihydro-1H-inden-2-yl]-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)N[C@@H]2Cc3ccccc3[C@H]2NC(=O)CCl)ccc1=O |
| InChI | InChI=1S/C20H23ClN4O3/c1-2-3-10-25-18(27)9-8-15(24-25)20(28)22-16-11-13-6-4-5-7-14(13)19(16)23-17(26)12-21/h4-9,16,19H,2-3,10-12H2,1H3,(H,22,28)(H,23,26)/t16-,19-/m1/s1 |
| InChIKey | MIXDWMXBRFVMDJ-VQIMIIECSA-N |
| XLogP | 1.79 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.88 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|