About 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide
1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide (PubChem CID 115880517) has the molecular formula C16H25N3O2
and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide |
| PubChem CID | 115880517 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide |
| SMILES | CCCCn1nc(C(=O)NC2CCC(C)(C)C2)ccc1=O |
| InChI | InChI=1S/C16H25N3O2/c1-4-5-10-19-14(20)7-6-13(18-19)15(21)17-12-8-9-16(2,3)11-12/h6-7,12H,4-5,8-11H2,1-3H3,(H,17,21) |
| InChIKey | IHTKSOKZCXGFOT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide?
The IUPAC name of 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide (CID 115880517) is 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide.
What is the SMILES notation for 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide?
The canonical SMILES for 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide is CCCCn1nc(C(=O)NC2CCC(C)(C)C2)ccc1=O.
What is the InChIKey of 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide?
The InChIKey is IHTKSOKZCXGFOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O2/c1-4-5-10-19-14(20)7-6-13(18-19)15(21)17-12-8-9-16(2,3)11-12/h6-7,12H,4-5,8-11H2,1-3H3,(H,17,21).
What are the key properties of 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide?
1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide has a molecular weight of 291.40 g/mol, XLogP of 2.35, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-N-(3,3-dimethylcyclopentyl)-6-oxopyridazine-3-carboxamide is sourced from PubChem (CID 115880517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).