C16H23N3O4 — CID 18080240
[2-(cyclopentylamino)-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate (PubChem CID 18080240) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 18080240 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] 1-butyl-6-oxopyridazine-3-carboxylate |
| SMILES | CCCCn1nc(C(=O)OCC(=O)NC2CCCC2)ccc1=O |
| InChI | InChI=1S/C16H23N3O4/c1-2-3-10-19-15(21)9-8-13(18-19)16(22)23-11-14(20)17-12-6-4-5-7-12/h8-9,12H,2-7,10-11H2,1H3,(H,17,20) |
| InChIKey | VMXNGCJBBQBMTD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |