C15H19N3O2 — CID 63118181
5-amino-N-(2-hydroxycyclohexyl)-1H-indole-2-carboxamide (PubChem CID 63118181) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-amino-N-(2-hydroxycyclohexyl)-1H-indole-2-carboxamide.
| Compound Name | 5-amino-N-(2-hydroxycyclohexyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 63118181 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-amino-N-(2-hydroxycyclohexyl)-1H-indole-2-carboxamide |
| SMILES | Nc1ccc2[nH]c(C(=O)NC3CCCCC3O)cc2c1 |
| InChI | InChI=1S/C15H19N3O2/c16-10-5-6-11-9(7-10)8-13(17-11)15(20)18-12-3-1-2-4-14(12)19/h5-8,12,14,17,19H,1-4,16H2,(H,18,20) |
| InChIKey | JAQMKYUSDLKSIR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|