C18H22N4O3 — CID 120556070
N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide (PubChem CID 120556070) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 120556070 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]-4-oxo-1H-quinoline-3-carboxamide |
| SMILES | CC1CNCCC1NC(=O)CNC(=O)c1c[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C18H22N4O3/c1-11-8-19-7-6-14(11)22-16(23)10-21-18(25)13-9-20-15-5-3-2-4-12(15)17(13)24/h2-5,9,11,14,19H,6-8,10H2,1H3,(H,20,24)(H,21,25)(H,22,23) |
| InChIKey | JFROAVCOSDNWCR-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 103.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |