C18H22N2O3 — CID 8606559
[2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 1H-indole-3-carboxylate (PubChem CID 8606559) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 1H-indole-3-carboxylate.
| Compound Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 8606559 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | [2-[[(1S,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] 1H-indole-3-carboxylate |
| SMILES | C[C@H]1CCCC[C@@H]1NC(=O)COC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C18H22N2O3/c1-12-6-2-4-8-15(12)20-17(21)11-23-18(22)14-10-19-16-9-5-3-7-13(14)16/h3,5,7,9-10,12,15,19H,2,4,6,8,11H2,1H3,(H,20,21)/t12-,15-/m0/s1 |
| InChIKey | ZQUYTYTYHGKRJC-WFASDCNBSA-N |
| XLogP | 3.02 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |