C18H21BrN2O3 — CID 46459756
[2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-bromo-1H-indole-2-carboxylate (PubChem CID 46459756) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-bromo-1H-indole-2-carboxylate.
| Compound Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-bromo-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46459756 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | [2-[(2-methylcyclohexyl)amino]-2-oxoethyl] 3-bromo-1H-indole-2-carboxylate |
| SMILES | CC1CCCCC1NC(=O)COC(=O)c1[nH]c2ccccc2c1Br |
| InChI | InChI=1S/C18H21BrN2O3/c1-11-6-2-4-8-13(11)20-15(22)10-24-18(23)17-16(19)12-7-3-5-9-14(12)21-17/h3,5,7,9,11,13,21H,2,4,6,8,10H2,1H3,(H,20,22) |
| InChIKey | XPHFBZMUUFDZAE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |