C15H19Cl2N3O2 — CID 120555666
3,4-dichloro-N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]benzamide (PubChem CID 120555666) has the molecular formula C15H19Cl2N3O2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 120555666 |
| Molecular Formula | C15H19Cl2N3O2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 3,4-dichloro-N-[2-[(3-methylpiperidin-4-yl)amino]-2-oxoethyl]benzamide |
| SMILES | CC1CNCCC1NC(=O)CNC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H19Cl2N3O2/c1-9-7-18-5-4-13(9)20-14(21)8-19-15(22)10-2-3-11(16)12(17)6-10/h2-3,6,9,13,18H,4-5,7-8H2,1H3,(H,19,22)(H,20,21) |
| InChIKey | SOBMHDSBEVELLC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |