C17H22N2O4 — CID 166532863
1-(4-methoxyoxolan-3-yl)-3-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]urea (PubChem CID 166532863) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-(4-methoxyoxolan-3-yl)-3-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]urea.
| Compound Name | 1-(4-methoxyoxolan-3-yl)-3-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 166532863 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-(4-methoxyoxolan-3-yl)-3-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]urea |
| SMILES | COC1COCC1NC(=O)N[C@@H](C)c1oc2ccccc2c1C |
| InChI | InChI=1S/C17H22N2O4/c1-10-12-6-4-5-7-14(12)23-16(10)11(2)18-17(20)19-13-8-22-9-15(13)21-3/h4-7,11,13,15H,8-9H2,1-3H3,(H2,18,19,20)/t11-,13?,15?/m0/s1 |
| InChIKey | FZPVEZZSTVVDFM-ZOODHJKOSA-N |
| XLogP | 2.52 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |