C19H26N2O4S — CID 166532648
1-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(4-methylsulfonylcyclohexyl)urea (PubChem CID 166532648) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is 1-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(4-methylsulfonylcyclohexyl)urea.
| Compound Name | 1-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(4-methylsulfonylcyclohexyl)urea |
|---|---|
| PubChem CID | 166532648 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 1-[(1R)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(4-methylsulfonylcyclohexyl)urea |
| SMILES | Cc1c([C@@H](C)NC(=O)NC2CCC(S(C)(=O)=O)CC2)oc2ccccc12 |
| InChI | InChI=1S/C19H26N2O4S/c1-12-16-6-4-5-7-17(16)25-18(12)13(2)20-19(22)21-14-8-10-15(11-9-14)26(3,23)24/h4-7,13-15H,8-11H2,1-3H3,(H2,20,21,22)/t13-,14?,15?/m1/s1 |
| InChIKey | QDWIWBWSNKZRHK-WLYUNCDWSA-N |
| XLogP | 3.46 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |