C18H23N3O3 — CID 166532014
1-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(1-methyl-6-oxopiperidin-3-yl)urea (PubChem CID 166532014) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(1-methyl-6-oxopiperidin-3-yl)urea.
| Compound Name | 1-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(1-methyl-6-oxopiperidin-3-yl)urea |
|---|---|
| PubChem CID | 166532014 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-[(1S)-1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(1-methyl-6-oxopiperidin-3-yl)urea |
| SMILES | Cc1c([C@H](C)NC(=O)NC2CCC(=O)N(C)C2)oc2ccccc12 |
| InChI | InChI=1S/C18H23N3O3/c1-11-14-6-4-5-7-15(14)24-17(11)12(2)19-18(23)20-13-8-9-16(22)21(3)10-13/h4-7,12-13H,8-10H2,1-3H3,(H2,19,20,23)/t12-,13?/m0/s1 |
| InChIKey | ZRLRFTMDJQZHKE-UEWDXFNNSA-N |
| XLogP | 2.72 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |