C18H24N2O3 — CID 166533084
1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(2-methyloxan-4-yl)urea (PubChem CID 166533084) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(2-methyloxan-4-yl)urea.
| Compound Name | 1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(2-methyloxan-4-yl)urea |
|---|---|
| PubChem CID | 166533084 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[1-(3-methyl-1-benzofuran-2-yl)ethyl]-3-(2-methyloxan-4-yl)urea |
| SMILES | Cc1c(C(C)NC(=O)NC2CCOC(C)C2)oc2ccccc12 |
| InChI | InChI=1S/C18H24N2O3/c1-11-10-14(8-9-22-11)20-18(21)19-13(3)17-12(2)15-6-4-5-7-16(15)23-17/h4-7,11,13-14H,8-10H2,1-3H3,(H2,19,20,21) |
| InChIKey | OEZJZCKMFBTVGW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |