C14H17F2NO3 — CID 91788905
2,6-difluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methylbenzamide (PubChem CID 91788905) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is 2,6-difluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methylbenzamide.
| Compound Name | 2,6-difluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 91788905 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2,6-difluoro-N-[(3S,4R)-3-methoxyoxan-4-yl]-3-methylbenzamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)c1c(F)ccc(C)c1F |
| InChI | InChI=1S/C14H17F2NO3/c1-8-3-4-9(15)12(13(8)16)14(18)17-10-5-6-20-7-11(10)19-2/h3-4,10-11H,5-7H2,1-2H3,(H,17,18)/t10-,11-/m1/s1 |
| InChIKey | MCMVJEUXSTUXQL-GHMZBOCLSA-N |
| XLogP | 1.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |