C12H15ClN2O3 — CID 91781029
3-chloro-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-4-carboxamide (PubChem CID 91781029) has the molecular formula C12H15ClN2O3 and a molecular weight of 270.72 g/mol. Its IUPAC name is 3-chloro-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-4-carboxamide.
| Compound Name | 3-chloro-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 91781029 |
| Molecular Formula | C12H15ClN2O3 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | 3-chloro-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-4-carboxamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)c1ccncc1Cl |
| InChI | InChI=1S/C12H15ClN2O3/c1-17-11-7-18-5-3-10(11)15-12(16)8-2-4-14-6-9(8)13/h2,4,6,10-11H,3,5,7H2,1H3,(H,15,16)/t10-,11-/m1/s1 |
| InChIKey | LXROGNZFMRHAAH-GHMZBOCLSA-N |
| XLogP | 1.27 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |