C13H18N2O4 — CID 91793620
6-methoxy-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-3-carboxamide (PubChem CID 91793620) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 6-methoxy-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91793620 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 6-methoxy-N-[(3S,4R)-3-methoxyoxan-4-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CCOC[C@H]2OC)cn1 |
| InChI | InChI=1S/C13H18N2O4/c1-17-11-8-19-6-5-10(11)15-13(16)9-3-4-12(18-2)14-7-9/h3-4,7,10-11H,5-6,8H2,1-2H3,(H,15,16)/t10-,11-/m1/s1 |
| InChIKey | DZBCWIZLALESRI-GHMZBOCLSA-N |
| XLogP | 0.62 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |