C15H21NO4S — CID 91762413
4-(2-hydroxyethylsulfanyl)-N-[(3S,4R)-3-methoxyoxan-4-yl]benzamide (PubChem CID 91762413) has the molecular formula C15H21NO4S and a molecular weight of 311.40 g/mol. Its IUPAC name is 4-(2-hydroxyethylsulfanyl)-N-[(3S,4R)-3-methoxyoxan-4-yl]benzamide.
| Compound Name | 4-(2-hydroxyethylsulfanyl)-N-[(3S,4R)-3-methoxyoxan-4-yl]benzamide |
|---|---|
| PubChem CID | 91762413 |
| Molecular Formula | C15H21NO4S |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-(2-hydroxyethylsulfanyl)-N-[(3S,4R)-3-methoxyoxan-4-yl]benzamide |
| SMILES | CO[C@@H]1COCC[C@H]1NC(=O)c1ccc(SCCO)cc1 |
| InChI | InChI=1S/C15H21NO4S/c1-19-14-10-20-8-6-13(14)16-15(18)11-2-4-12(5-3-11)21-9-7-17/h2-5,13-14,17H,6-10H2,1H3,(H,16,18)/t13-,14-/m1/s1 |
| InChIKey | NSLZBQPHNFDCNE-ZIAGYGMSSA-N |
| XLogP | 1.30 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |