C17H24N2O5S — CID 164630095
3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(3R,4S)-3-methoxyoxan-4-yl]benzamide (PubChem CID 164630095) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(3R,4S)-3-methoxyoxan-4-yl]benzamide.
| Compound Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(3R,4S)-3-methoxyoxan-4-yl]benzamide |
|---|---|
| PubChem CID | 164630095 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 3-(1,1-dioxo-1,4-thiazinan-4-yl)-N-[(3R,4S)-3-methoxyoxan-4-yl]benzamide |
| SMILES | CO[C@H]1COCC[C@@H]1NC(=O)c1cccc(N2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C17H24N2O5S/c1-23-16-12-24-8-5-15(16)18-17(20)13-3-2-4-14(11-13)19-6-9-25(21,22)10-7-19/h2-4,11,15-16H,5-10,12H2,1H3,(H,18,20)/t15-,16-/m0/s1 |
| InChIKey | VNBLBEADIOQQCN-HOTGVXAUSA-N |
| XLogP | 0.46 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |