C19H23FN2O2 — CID 164696251
(7-fluoro-3-methyl-1H-indol-2-yl)-[(4R,5S)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]methanone (PubChem CID 164696251) has the molecular formula C19H23FN2O2 and a molecular weight of 330.40 g/mol. Its IUPAC name is (7-fluoro-3-methyl-1H-indol-2-yl)-[(4R,5S)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]methanone.
| Compound Name | (7-fluoro-3-methyl-1H-indol-2-yl)-[(4R,5S)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]methanone |
|---|---|
| PubChem CID | 164696251 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | (7-fluoro-3-methyl-1H-indol-2-yl)-[(4R,5S)-4-hydroxy-7-azaspiro[4.5]decan-7-yl]methanone |
| SMILES | Cc1c(C(=O)N2CCC[C@@]3(CCC[C@H]3O)C2)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C19H23FN2O2/c1-12-13-5-2-6-14(20)17(13)21-16(12)18(24)22-10-4-9-19(11-22)8-3-7-15(19)23/h2,5-6,15,21,23H,3-4,7-11H2,1H3/t15-,19+/m1/s1 |
| InChIKey | CFZPDQCMRIZOHG-BEFAXECRSA-N |
| XLogP | 3.38 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|