C20H24FN3O3 — CID 162628738
1-(7-fluoro-3-methyl-1H-indole-2-carbonyl)-9-(2-hydroxyethyl)-1,9-diazaspiro[4.5]decan-10-one (PubChem CID 162628738) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is 1-(7-fluoro-3-methyl-1H-indole-2-carbonyl)-9-(2-hydroxyethyl)-1,9-diazaspiro[4.5]decan-10-one.
| Compound Name | 1-(7-fluoro-3-methyl-1H-indole-2-carbonyl)-9-(2-hydroxyethyl)-1,9-diazaspiro[4.5]decan-10-one |
|---|---|
| PubChem CID | 162628738 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 1-(7-fluoro-3-methyl-1H-indole-2-carbonyl)-9-(2-hydroxyethyl)-1,9-diazaspiro[4.5]decan-10-one |
| SMILES | Cc1c(C(=O)N2CCCC23CCCN(CCO)C3=O)[nH]c2c(F)cccc12 |
| InChI | InChI=1S/C20H24FN3O3/c1-13-14-5-2-6-15(21)17(14)22-16(13)18(26)24-10-4-8-20(24)7-3-9-23(11-12-25)19(20)27/h2,5-6,22,25H,3-4,7-12H2,1H3 |
| InChIKey | RIJKOSDFCMSKGF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|