C18H25N3O4 — CID 155913999
N-[(3S,3aR,6S,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 155913999) has the molecular formula C18H25N3O4 and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 155913999 |
| Molecular Formula | C18H25N3O4 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)N[C@H]3CO[C@H]4[C@@H]3OC[C@@H]4O)cc2)CC1 |
| InChI | InChI=1S/C18H25N3O4/c1-20-6-8-21(9-7-20)13-4-2-12(3-5-13)18(23)19-14-10-24-17-15(22)11-25-16(14)17/h2-5,14-17,22H,6-11H2,1H3,(H,19,23)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | AHHYXNVNJJVIIQ-MWDXBVQZSA-N |
| XLogP | -0.30 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |