C21H32N4O3 — CID 154571022
N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(4-methylpiperazin-1-yl)benzamide (PubChem CID 154571022) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(4-methylpiperazin-1-yl)benzamide.
| Compound Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(4-methylpiperazin-1-yl)benzamide |
|---|---|
| PubChem CID | 154571022 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-(4-methylpiperazin-1-yl)benzamide |
| SMILES | CN1CCN(c2ccc(C(=O)N[C@H]3C[C@H]4CO[C@@H](CCO)CN4C3)cc2)CC1 |
| InChI | InChI=1S/C21H32N4O3/c1-23-7-9-24(10-8-23)18-4-2-16(3-5-18)21(27)22-17-12-19-15-28-20(6-11-26)14-25(19)13-17/h2-5,17,19-20,26H,6-15H2,1H3,(H,22,27)/t17-,19-,20-/m0/s1 |
| InChIKey | VDFODDARXYHUQA-IHPCNDPISA-N |
| XLogP | 0.39 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |