C16H23N3O4 — CID 154818971
N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methoxypyridine-4-carboxamide (PubChem CID 154818971) has the molecular formula C16H23N3O4 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methoxypyridine-4-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methoxypyridine-4-carboxamide |
|---|---|
| PubChem CID | 154818971 |
| Molecular Formula | C16H23N3O4 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-methoxypyridine-4-carboxamide |
| SMILES | COc1cc(C(=O)N[C@H]2C[C@H]3CO[C@@H](CCO)CN3C2)ccn1 |
| InChI | InChI=1S/C16H23N3O4/c1-22-15-6-11(2-4-17-15)16(21)18-12-7-13-10-23-14(3-5-20)9-19(13)8-12/h2,4,6,12-14,20H,3,5,7-10H2,1H3,(H,18,21)/t12-,13-,14-/m0/s1 |
| InChIKey | YHVRVVVQUGPVNZ-IHRRRGAJSA-N |
| XLogP | 0.04 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |