C19H25N3O4 — CID 155509396
N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-methoxy-1H-indole-2-carboxamide (PubChem CID 155509396) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155509396 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-4-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N[C@H]3C[C@H]4CO[C@@H](CCO)CN4C3)cc12 |
| InChI | InChI=1S/C19H25N3O4/c1-25-18-4-2-3-16-15(18)8-17(21-16)19(24)20-12-7-13-11-26-14(5-6-23)10-22(13)9-12/h2-4,8,12-14,21,23H,5-7,9-11H2,1H3,(H,20,24)/t12-,13-,14-/m0/s1 |
| InChIKey | LXIOQOWHTKXUDB-IHRRRGAJSA-N |
| XLogP | 1.13 |
| TPSA | 86.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |