C19H27N3O3 — CID 155917444
N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5,6,7,8-tetrahydroquinoline-3-carboxamide (PubChem CID 155917444) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5,6,7,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5,6,7,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 155917444 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5,6,7,8-tetrahydroquinoline-3-carboxamide |
| SMILES | O=C(N[C@H]1C[C@H]2CO[C@@H](CCO)CN2C1)c1cnc2c(c1)CCCC2 |
| InChI | InChI=1S/C19H27N3O3/c23-6-5-17-11-22-10-15(8-16(22)12-25-17)21-19(24)14-7-13-3-1-2-4-18(13)20-9-14/h7,9,15-17,23H,1-6,8,10-12H2,(H,21,24)/t15-,16-,17-/m0/s1 |
| InChIKey | PPAZWUULIFWVRA-ULQDDVLXSA-N |
| XLogP | 0.91 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |