C20H25N5O3 — CID 155509787
N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-4-phenylpyrimidine-5-carboxamide (PubChem CID 155509787) has the molecular formula C20H25N5O3 and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-4-phenylpyrimidine-5-carboxamide.
| Compound Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-4-phenylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155509787 |
| Molecular Formula | C20H25N5O3 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.20 |
| IUPAC Name | N-[(3S,7S,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-2-amino-4-phenylpyrimidine-5-carboxamide |
| SMILES | Nc1ncc(C(=O)N[C@H]2C[C@H]3CO[C@@H](CCO)CN3C2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H25N5O3/c21-20-22-9-17(18(24-20)13-4-2-1-3-5-13)19(27)23-14-8-15-12-28-16(6-7-26)11-25(15)10-14/h1-5,9,14-16,26H,6-8,10-12H2,(H,23,27)(H2,21,22,24)/t14-,15-,16-/m0/s1 |
| InChIKey | KDWZVTMBCPLYQJ-JYJNAYRXSA-N |
| XLogP | 0.68 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |