C15H24N4O5 — CID 163334480
N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methyl-1H-imidazole-4-carboxamide;formic acid (PubChem CID 163334480) has the molecular formula C15H24N4O5 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methyl-1H-imidazole-4-carboxamide;formic acid.
| Compound Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methyl-1H-imidazole-4-carboxamide;formic acid |
|---|---|
| PubChem CID | 163334480 |
| Molecular Formula | C15H24N4O5 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[(3S,7R,8aS)-3-(2-hydroxyethyl)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-7-yl]-5-methyl-1H-imidazole-4-carboxamide;formic acid |
| SMILES | Cc1[nH]cnc1C(=O)N[C@@H]1C[C@H]2CO[C@@H](CCO)CN2C1.O=CO |
| InChI | InChI=1S/C14H22N4O3.CH2O2/c1-9-13(16-8-15-9)14(20)17-10-4-11-7-21-12(2-3-19)6-18(11)5-10;2-1-3/h8,10-12,19H,2-7H2,1H3,(H,15,16)(H,17,20);1H,(H,2,3)/t10-,11+,12+;/m1./s1 |
| InChIKey | FAQXVEVXNHOUJK-FVDRTDNTSA-N |
| XLogP | -0.63 |
| TPSA | 127.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|