C14H18N2O4S — CID 162807850
1-[(3R,3aR,6R,6aS)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-methylsulfanylphenyl)urea (PubChem CID 162807850) has the molecular formula C14H18N2O4S and a molecular weight of 310.38 g/mol. Its IUPAC name is 1-[(3R,3aR,6R,6aS)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-methylsulfanylphenyl)urea.
| Compound Name | 1-[(3R,3aR,6R,6aS)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 162807850 |
| Molecular Formula | C14H18N2O4S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[(3R,3aR,6R,6aS)-6-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-3-(3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)N[C@@H]2CO[C@@H]3[C@@H]2OC[C@H]3O)c1 |
| InChI | InChI=1S/C14H18N2O4S/c1-21-9-4-2-3-8(5-9)15-14(18)16-10-6-19-13-11(17)7-20-12(10)13/h2-5,10-13,17H,6-7H2,1H3,(H2,15,16,18)/t10-,11-,12-,13+/m1/s1 |
| InChIKey | MRFCMIPETLABKQ-LPWJVIDDSA-N |
| XLogP | 1.06 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |