C19H18ClN3O2 — CID 156585222
4-chloro-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide (PubChem CID 156585222) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is 4-chloro-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide.
| Compound Name | 4-chloro-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 156585222 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 4-chloro-N-[(3R,4S)-4-(pyridin-4-ylmethyl)oxolan-3-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(N[C@H]1COC[C@H]1Cc1ccncc1)c1cc2c(Cl)cccc2[nH]1 |
| InChI | InChI=1S/C19H18ClN3O2/c20-15-2-1-3-16-14(15)9-17(22-16)19(24)23-18-11-25-10-13(18)8-12-4-6-21-7-5-12/h1-7,9,13,18,22H,8,10-11H2,(H,23,24)/t13-,18+/m1/s1 |
| InChIKey | INMWSSAMILJVLY-ACJLOTCBSA-N |
| XLogP | 3.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |