C22H24N4O4S — CID 4510725
N-[4-[[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide (PubChem CID 4510725) has the molecular formula C22H24N4O4S and a molecular weight of 440.53 g/mol. Its IUPAC name is N-[4-[[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide.
| Compound Name | N-[4-[[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 4510725 |
| Molecular Formula | C22H24N4O4S |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | N-[4-[[3-(furan-2-yl)prop-2-enoylcarbamothioylamino]carbamoyl]phenyl]cyclohexanecarboxamide |
| SMILES | O=C(C=Cc1ccco1)NC(=S)NNC(=O)c1ccc(NC(=O)C2CCCCC2)cc1 |
| InChI | InChI=1S/C22H24N4O4S/c27-19(13-12-18-7-4-14-30-18)24-22(31)26-25-21(29)16-8-10-17(11-9-16)23-20(28)15-5-2-1-3-6-15/h4,7-15H,1-3,5-6H2,(H,23,28)(H,25,29)(H2,24,26,27,31) |
| InChIKey | DAOPKHTXDQDVRJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|