C20H23N3O5S2 — CID 17353818
4-(2-methoxyethoxy)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17353818) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-(2-methoxyethoxy)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-(2-methoxyethoxy)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17353818 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 4-(2-methoxyethoxy)-N-[[4-(prop-2-enylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccc(OCCOC)cc2)cc1 |
| InChI | InChI=1S/C20H23N3O5S2/c1-3-12-21-30(25,26)18-10-6-16(7-11-18)22-20(29)23-19(24)15-4-8-17(9-5-15)28-14-13-27-2/h3-11,21H,1,12-14H2,2H3,(H2,22,23,24,29) |
| InChIKey | HYIGLRXXODWWII-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|