C17H15N3O5S2 — CID 4788612
N-(furan-2-ylmethyl)-4-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide (PubChem CID 4788612) has the molecular formula C17H15N3O5S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 4788612 |
| Molecular Formula | C17H15N3O5S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[(thiophene-2-carbonylamino)carbamoyl]benzenesulfonamide |
| SMILES | O=C(NNC(=O)c1cccs1)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C17H15N3O5S2/c21-16(19-20-17(22)15-4-2-10-26-15)12-5-7-14(8-6-12)27(23,24)18-11-13-3-1-9-25-13/h1-10,18H,11H2,(H,19,21)(H,20,22) |
| InChIKey | ZICXKPYPEJNVNQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|