C28H35N5O6 — CID 163479471
2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl 3-[butyl(2-prop-2-enoyloxyethylcarbamoyl)amino]-2-methylpropanoate (PubChem CID 163479471) has the molecular formula C28H35N5O6 and a molecular weight of 537.62 g/mol. Its IUPAC name is 2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl 3-[butyl(2-prop-2-enoyloxyethylcarbamoyl)amino]-2-methylpropanoate.
| Compound Name | 2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl 3-[butyl(2-prop-2-enoyloxyethylcarbamoyl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 163479471 |
| Molecular Formula | C28H35N5O6 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | 2-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]ethyl 3-[butyl(2-prop-2-enoyloxyethylcarbamoyl)amino]-2-methylpropanoate |
| SMILES | C=CC(=O)OCCNC(=O)N(CCCC)CC(C)C(=O)OCCc1ccc(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C28H35N5O6/c1-4-6-15-32(28(37)29-14-17-38-26(35)5-2)19-20(3)27(36)39-16-13-21-11-12-25(34)24(18-21)33-30-22-9-7-8-10-23(22)31-33/h5,7-12,18,20,34H,2,4,6,13-17,19H2,1,3H3,(H,29,37) |
| InChIKey | CDGVYVNVLKBALC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|