C26H31N5O5 — CID 162770526
methyl (2S)-6-amino-2-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoyl-(2-methylprop-2-enoyl)amino]hexanoate (PubChem CID 162770526) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is methyl (2S)-6-amino-2-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoyl-(2-methylprop-2-enoyl)amino]hexanoate.
| Compound Name | methyl (2S)-6-amino-2-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoyl-(2-methylprop-2-enoyl)amino]hexanoate |
|---|---|
| PubChem CID | 162770526 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | methyl (2S)-6-amino-2-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoyl-(2-methylprop-2-enoyl)amino]hexanoate |
| SMILES | C=C(C)C(=O)N(C(=O)CCc1ccc(O)c(-n2nc3ccccc3n2)c1)[C@@H](CCCCN)C(=O)OC |
| InChI | InChI=1S/C26H31N5O5/c1-17(2)25(34)30(21(26(35)36-3)10-6-7-15-27)24(33)14-12-18-11-13-23(32)22(16-18)31-28-19-8-4-5-9-20(19)29-31/h4-5,8-9,11,13,16,21,32H,1,6-7,10,12,14-15,27H2,2-3H3/t21-/m0/s1 |
| InChIKey | XCLCRWUDNJMNEI-NRFANRHFSA-N |
| XLogP | 2.66 |
| TPSA | 140.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|