C26H31N5O5 — CID 162770528
methyl (2S)-6-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoylamino]-2-(2-methylprop-2-enoylamino)hexanoate (PubChem CID 162770528) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is methyl (2S)-6-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoylamino]-2-(2-methylprop-2-enoylamino)hexanoate.
| Compound Name | methyl (2S)-6-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoylamino]-2-(2-methylprop-2-enoylamino)hexanoate |
|---|---|
| PubChem CID | 162770528 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | methyl (2S)-6-[3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propanoylamino]-2-(2-methylprop-2-enoylamino)hexanoate |
| SMILES | C=C(C)C(=O)N[C@@H](CCCCNC(=O)CCc1ccc(O)c(-n2nc3ccccc3n2)c1)C(=O)OC |
| InChI | InChI=1S/C26H31N5O5/c1-17(2)25(34)28-21(26(35)36-3)10-6-7-15-27-24(33)14-12-18-11-13-23(32)22(16-18)31-29-19-8-4-5-9-20(19)30-31/h4-5,8-9,11,13,16,21,32H,1,6-7,10,12,14-15H2,2-3H3,(H,27,33)(H,28,34)/t21-/m0/s1 |
| InChIKey | ZVRSJNICARMPCJ-NRFANRHFSA-N |
| XLogP | 2.58 |
| TPSA | 135.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|