C19H19N3O3 — CID 123886929
1-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]heptane-3,4-dione (PubChem CID 123886929) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 1-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]heptane-3,4-dione.
| Compound Name | 1-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]heptane-3,4-dione |
|---|---|
| PubChem CID | 123886929 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 1-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]heptane-3,4-dione |
| SMILES | CCCC(=O)C(=O)CCc1ccc(-n2nc3ccccc3n2)c(O)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-5-17(23)18(24)11-9-13-8-10-16(19(25)12-13)22-20-14-6-3-4-7-15(14)21-22/h3-4,6-8,10,12,25H,2,5,9,11H2,1H3 |
| InChIKey | ZCDJHZKPZJOIDN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|