C33H38ClN3O7S — CID 58729271
1-O-[2-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]ethyl] 5-O-butyl 2-chloro-2,4-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]pentanedioate (PubChem CID 58729271) has the molecular formula C33H38ClN3O7S and a molecular weight of 656.20 g/mol. Its IUPAC name is 1-O-[2-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]ethyl] 5-O-butyl 2-chloro-2,4-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]pentanedioate.
| Compound Name | 1-O-[2-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]ethyl] 5-O-butyl 2-chloro-2,4-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]pentanedioate |
|---|---|
| PubChem CID | 58729271 |
| Molecular Formula | C33H38ClN3O7S |
| Molecular Weight | 656.20 g/mol |
| Exact Mass | 655.21 |
| IUPAC Name | 1-O-[2-[4-(benzotriazol-2-yl)-3-hydroxyphenyl]ethyl] 5-O-butyl 2-chloro-2,4-dimethyl-4-[(4-methylphenyl)sulfonylmethyl]pentanedioate |
| SMILES | CCCCOC(=O)C(C)(CC(C)(Cl)C(=O)OCCc1ccc(-n2nc3ccccc3n2)c(O)c1)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H38ClN3O7S/c1-5-6-18-43-30(39)32(3,22-45(41,42)25-14-11-23(2)12-15-25)21-33(4,34)31(40)44-19-17-24-13-16-28(29(38)20-24)37-35-26-9-7-8-10-27(26)36-37/h7-16,20,38H,5-6,17-19,21-22H2,1-4H3 |
| InChIKey | MWGVLBJHNSIVHH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 137.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.20 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|