C36H53ClO7S — CID 58729265
1-O-butyl 5-O-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl] 4-chloro-2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate (PubChem CID 58729265) has the molecular formula C36H53ClO7S and a molecular weight of 665.33 g/mol. Its IUPAC name is 1-O-butyl 5-O-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl] 4-chloro-2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate.
| Compound Name | 1-O-butyl 5-O-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl] 4-chloro-2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate |
|---|---|
| PubChem CID | 58729265 |
| Molecular Formula | C36H53ClO7S |
| Molecular Weight | 665.33 g/mol |
| Exact Mass | 664.32 |
| IUPAC Name | 1-O-butyl 5-O-[3-(3,5-ditert-butyl-4-hydroxyphenyl)propyl] 4-chloro-2,4-dimethyl-2-[(4-methylphenyl)sulfonylmethyl]pentanedioate |
| SMILES | CCCCOC(=O)C(C)(CC(C)(Cl)C(=O)OCCCc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)CS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H53ClO7S/c1-11-12-19-43-31(39)35(9,24-45(41,42)27-17-15-25(2)16-18-27)23-36(10,37)32(40)44-20-13-14-26-21-28(33(3,4)5)30(38)29(22-26)34(6,7)8/h15-18,21-22,38H,11-14,19-20,23-24H2,1-10H3 |
| InChIKey | SBSMRJFIYQHMRK-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.33 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|