C11H14ClN3O3 — CID 160917790
2H-benzotriazol-4-ol;2-methylpropyl carbonochloridate (PubChem CID 160917790) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is 2H-benzotriazol-4-ol;2-methylpropyl carbonochloridate.
| Compound Name | 2H-benzotriazol-4-ol;2-methylpropyl carbonochloridate |
|---|---|
| PubChem CID | 160917790 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 2H-benzotriazol-4-ol;2-methylpropyl carbonochloridate |
| SMILES | CC(C)COC(=O)Cl.Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C6H5N3O.C5H9ClO2/c10-5-3-1-2-4-6(5)8-9-7-4;1-4(2)3-8-5(6)7/h1-3,10H,(H,7,8,9);4H,3H2,1-2H3 |
| InChIKey | SRQBZPSUMSNMKX-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|