About 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate
2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate (PubChem CID 122616864) has the molecular formula C16H12N6O6
and a molecular weight of 384.31 g/mol. Its IUPAC name is 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate.
Molecular Properties
| Compound Name | 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate |
| PubChem CID | 122616864 |
| Molecular Formula | C16H12N6O6 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate |
| SMILES | O=C(OCCOC(=O)Oc1cccc2n[nH]nc12)Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C16H12N6O6/c23-15(27-11-5-1-3-9-13(11)19-21-17-9)25-7-8-26-16(24)28-12-6-2-4-10-14(12)20-22-18-10/h1-6H,7-8H2,(H,17,19,21)(H,18,20,22) |
| InChIKey | IKQYDVAVRUSSFU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 154.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate?
The IUPAC name of 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate (CID 122616864) is 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate.
What is the SMILES notation for 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate?
The canonical SMILES for 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate is O=C(OCCOC(=O)Oc1cccc2n[nH]nc12)Oc1cccc2n[nH]nc12.
What is the InChIKey of 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate?
The InChIKey is IKQYDVAVRUSSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N6O6/c23-15(27-11-5-1-3-9-13(11)19-21-17-9)25-7-8-26-16(24)28-12-6-2-4-10-14(12)20-22-18-10/h1-6H,7-8H2,(H,17,19,21)(H,18,20,22).
What are the key properties of 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate?
2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate has a molecular weight of 384.31 g/mol, XLogP of 1.96, 5 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-benzotriazol-4-yl 2-(2H-benzotriazol-4-yloxycarbonyloxy)ethyl carbonate is sourced from PubChem (CID 122616864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).