C12H17N7O2 — CID 67900602
2H-benzotriazol-4-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 67900602) has the molecular formula C12H17N7O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2H-benzotriazol-4-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | 2H-benzotriazol-4-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 67900602 |
| Molecular Formula | C12H17N7O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2H-benzotriazol-4-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Oc1cccc2n[nH]nc12 |
| InChI | InChI=1S/C12H17N7O2/c13-7(3-2-6-16-12(14)15)11(20)21-9-5-1-4-8-10(9)18-19-17-8/h1,4-5,7H,2-3,6,13H2,(H4,14,15,16)(H,17,18,19)/t7-/m0/s1 |
| InChIKey | SYCQNWBNFRIFEL-ZETCQYMHSA-N |
| XLogP | -0.76 |
| TPSA | 158.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|