C9H15N5O2S — CID 175542389
1,3-thiazol-2-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 175542389) has the molecular formula C9H15N5O2S and a molecular weight of 257.32 g/mol. Its IUPAC name is 1,3-thiazol-2-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | 1,3-thiazol-2-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 175542389 |
| Molecular Formula | C9H15N5O2S |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1,3-thiazol-2-yl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)Oc1nccs1 |
| InChI | InChI=1S/C9H15N5O2S/c10-6(2-1-3-13-8(11)12)7(15)16-9-14-4-5-17-9/h4-6H,1-3,10H2,(H4,11,12,13)/t6-/m0/s1 |
| InChIKey | YWJCVRGACFWOQP-LURJTMIESA-N |
| XLogP | -0.57 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|