C7H18N4O4Si — CID 21304331
[dihydroxy(methyl)silyl] 2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 21304331) has the molecular formula C7H18N4O4Si and a molecular weight of 250.33 g/mol. Its IUPAC name is [dihydroxy(methyl)silyl] 2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | [dihydroxy(methyl)silyl] 2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 21304331 |
| Molecular Formula | C7H18N4O4Si |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | [dihydroxy(methyl)silyl] 2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | C[Si](O)(O)OC(=O)C(N)CCCN=C(N)N |
| InChI | InChI=1S/C7H18N4O4Si/c1-16(13,14)15-6(12)5(8)3-2-4-11-7(9)10/h5,13-14H,2-4,8H2,1H3,(H4,9,10,11) |
| InChIKey | KPRRIJBCTAIFMQ-UHFFFAOYSA-N |
| XLogP | -2.54 |
| TPSA | 157.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|