C7H18Cl2N4O2 — CID 166484368
trideuteriomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride (PubChem CID 166484368) has the molecular formula C7H18Cl2N4O2 and a molecular weight of 264.17 g/mol. Its IUPAC name is trideuteriomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride.
| Compound Name | trideuteriomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
|---|---|
| PubChem CID | 166484368 |
| Molecular Formula | C7H18Cl2N4O2 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | trideuteriomethyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate;dihydrochloride |
| SMILES | Cl.Cl.[2H]C([2H])([2H])OC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C7H16N4O2.2ClH/c1-13-6(12)5(8)3-2-4-11-7(9)10;;/h5H,2-4,8H2,1H3,(H4,9,10,11);2*1H/t5-;;/m0../s1/i1D3;; |
| InChIKey | XQYZOBNLCUAXLF-RLELISFJSA-N |
| XLogP | -0.62 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|