C10H16N6O — CID 175118593
2-(4-amino-5-oxo-5-pyrimidin-2-ylpentyl)guanidine (PubChem CID 175118593) has the molecular formula C10H16N6O and a molecular weight of 236.28 g/mol. Its IUPAC name is 2-(4-amino-5-oxo-5-pyrimidin-2-ylpentyl)guanidine.
| Compound Name | 2-(4-amino-5-oxo-5-pyrimidin-2-ylpentyl)guanidine |
|---|---|
| PubChem CID | 175118593 |
| Molecular Formula | C10H16N6O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | 2-(4-amino-5-oxo-5-pyrimidin-2-ylpentyl)guanidine |
| SMILES | NC(N)=NCCCC(N)C(=O)c1ncccn1 |
| InChI | InChI=1S/C10H16N6O/c11-7(3-1-4-16-10(12)13)8(17)9-14-5-2-6-15-9/h2,5-7H,1,3-4,11H2,(H4,12,13,16) |
| InChIKey | VLOUVSLAMOBMQH-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|