C18H21BF2N4O2 — CID 177473682
bis(4-fluorophenyl)boranyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 177473682) has the molecular formula C18H21BF2N4O2 and a molecular weight of 374.20 g/mol. Its IUPAC name is bis(4-fluorophenyl)boranyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | bis(4-fluorophenyl)boranyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 177473682 |
| Molecular Formula | C18H21BF2N4O2 |
| Molecular Weight | 374.20 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | bis(4-fluorophenyl)boranyl (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(N)=NCCC[C@H](N)C(=O)OB(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21BF2N4O2/c20-14-7-3-12(4-8-14)19(13-5-9-15(21)10-6-13)27-17(26)16(22)2-1-11-25-18(23)24/h3-10,16H,1-2,11,22H2,(H4,23,24,25)/t16-/m0/s1 |
| InChIKey | BNYFQQIXUXWIOW-INIZCTEOSA-N |
| XLogP | -0.01 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.20 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|