C7H16N6O2S — CID 174223405
(carbamothioylamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate (PubChem CID 174223405) has the molecular formula C7H16N6O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is (carbamothioylamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate.
| Compound Name | (carbamothioylamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
|---|---|
| PubChem CID | 174223405 |
| Molecular Formula | C7H16N6O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | (carbamothioylamino) (2S)-2-amino-5-(diaminomethylideneamino)pentanoate |
| SMILES | NC(=S)NOC(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C7H16N6O2S/c8-4(2-1-3-12-6(9)10)5(14)15-13-7(11)16/h4H,1-3,8H2,(H4,9,10,12)(H3,11,13,16)/t4-/m0/s1 |
| InChIKey | AOEBMHNSSKYWDV-BYPYZUCNSA-N |
| XLogP | -2.34 |
| TPSA | 154.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|