2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate

C15H16O4 — CID 18787642

IUPAC2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate
SMILESCC(C)COC(=O)c1cc2cccc(O)c2cc1O
InChIInChI=1S/C15H16O4/c1-9(2)8-19-15(18)12-6-10-4-3-5-13(16)11(10)7-14(12)17/h3-7,9,16-17H,8H2,1-2H3
InChIKeyWZKOWIQUGZLIHW-UHFFFAOYSA-N
MW260.29 g/mol
LogP3.06
Rot. Bonds3

About 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate

2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate (PubChem CID 18787642) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate.

Molecular Properties

Compound Name2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate
PubChem CID18787642
Molecular FormulaC15H16O4
Molecular Weight260.29 g/mol
Exact Mass260.10
IUPAC Name2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate
SMILESCC(C)COC(=O)c1cc2cccc(O)c2cc1O
InChIInChI=1S/C15H16O4/c1-9(2)8-19-15(18)12-6-10-4-3-5-13(16)11(10)7-14(12)17/h3-7,9,16-17H,8H2,1-2H3
InChIKeyWZKOWIQUGZLIHW-UHFFFAOYSA-N
XLogP3.06
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.29
LogP ≤ 53.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate?
The IUPAC name of 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate (CID 18787642) is 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate.
What is the SMILES notation for 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate?
The canonical SMILES for 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate is CC(C)COC(=O)c1cc2cccc(O)c2cc1O.
What is the InChIKey of 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate?
The InChIKey is WZKOWIQUGZLIHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O4/c1-9(2)8-19-15(18)12-6-10-4-3-5-13(16)11(10)7-14(12)17/h3-7,9,16-17H,8H2,1-2H3.
What are the key properties of 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate?
2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate has a molecular weight of 260.29 g/mol, XLogP of 3.06, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate is sourced from PubChem (CID 18787642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).