C15H16O4 — CID 18787642
2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate (PubChem CID 18787642) has the molecular formula C15H16O4 and a molecular weight of 260.29 g/mol. Its IUPAC name is 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate.
| Compound Name | 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 18787642 |
| Molecular Formula | C15H16O4 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 2-methylpropyl 3,5-dihydroxynaphthalene-2-carboxylate |
| SMILES | CC(C)COC(=O)c1cc2cccc(O)c2cc1O |
| InChI | InChI=1S/C15H16O4/c1-9(2)8-19-15(18)12-6-10-4-3-5-13(16)11(10)7-14(12)17/h3-7,9,16-17H,8H2,1-2H3 |
| InChIKey | WZKOWIQUGZLIHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |