C30H28O6 — CID 165391085
bis(2-methylpropyl) 4,10-dihydroxyperylene-3,9-dicarboxylate (PubChem CID 165391085) has the molecular formula C30H28O6 and a molecular weight of 484.55 g/mol. Its IUPAC name is bis(2-methylpropyl) 4,10-dihydroxyperylene-3,9-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 4,10-dihydroxyperylene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 165391085 |
| Molecular Formula | C30H28O6 |
| Molecular Weight | 484.55 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | bis(2-methylpropyl) 4,10-dihydroxyperylene-3,9-dicarboxylate |
| SMILES | CC(C)COC(=O)c1ccc2c3ccc(O)c4c(C(=O)OCC(C)C)ccc(c5ccc(O)c1c52)c43 |
| InChI | InChI=1S/C30H28O6/c1-15(2)13-35-29(33)21-7-5-17-20-10-12-24(32)28-22(30(34)36-14-16(3)4)8-6-18(26(20)28)19-9-11-23(31)27(21)25(17)19/h5-12,15-16,31-32H,13-14H2,1-4H3 |
| InChIKey | XALOCXDUPOJQJQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.55 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|