C30H26I2O4 — CID 165391087
bis(2-methylpropyl) 4,9-diiodoperylene-3,10-dicarboxylate (PubChem CID 165391087) has the molecular formula C30H26I2O4 and a molecular weight of 704.34 g/mol. Its IUPAC name is bis(2-methylpropyl) 4,9-diiodoperylene-3,10-dicarboxylate.
| Compound Name | bis(2-methylpropyl) 4,9-diiodoperylene-3,10-dicarboxylate |
|---|---|
| PubChem CID | 165391087 |
| Molecular Formula | C30H26I2O4 |
| Molecular Weight | 704.34 g/mol |
| Exact Mass | 703.99 |
| IUPAC Name | bis(2-methylpropyl) 4,9-diiodoperylene-3,10-dicarboxylate |
| SMILES | CC(C)COC(=O)c1ccc2c3ccc(C(=O)OCC(C)C)c4c(I)ccc(c5ccc(I)c1c52)c43 |
| InChI | InChI=1S/C30H26I2O4/c1-15(2)13-35-29(33)21-7-5-17-18-6-8-22(30(34)36-14-16(3)4)28-24(32)12-10-20(26(18)28)19-9-11-23(31)27(21)25(17)19/h5-12,15-16H,13-14H2,1-4H3 |
| InChIKey | CFQWSQTXSHLNPV-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.34 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|